C28H22N2O7 — CID 108715724
(4Z)-1-(1,3-benzodioxol-5-yl)-5-(3-ethoxy-4-hydroxyphenyl)-4-[hydroxy(1H-indol-3-yl)methylidene]pyrrolidine-2,3-dione (PubChem CID 108715724) has the molecular formula C28H22N2O7 and a molecular weight of 498.49 g/mol. Its IUPAC name is (4Z)-1-(1,3-benzodioxol-5-yl)-5-(3-ethoxy-4-hydroxyphenyl)-4-[hydroxy(1H-indol-3-yl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-(1,3-benzodioxol-5-yl)-5-(3-ethoxy-4-hydroxyphenyl)-4-[hydroxy(1H-indol-3-yl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108715724 |
| Molecular Formula | C28H22N2O7 |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | (4Z)-1-(1,3-benzodioxol-5-yl)-5-(3-ethoxy-4-hydroxyphenyl)-4-[hydroxy(1H-indol-3-yl)methylidene]pyrrolidine-2,3-dione |
| SMILES | CCOc1cc(C2/C(=C(/O)c3c[nH]c4ccccc34)C(=O)C(=O)N2c2ccc3c(c2)OCO3)ccc1O |
| InChI | InChI=1S/C28H22N2O7/c1-2-35-22-11-15(7-9-20(22)31)25-24(26(32)18-13-29-19-6-4-3-5-17(18)19)27(33)28(34)30(25)16-8-10-21-23(12-16)37-14-36-21/h3-13,25,29,31-32H,2,14H2,1H3/b26-24- |
| InChIKey | SJNLCSCQQDLVOQ-LCUIJRPUSA-N |
| XLogP | 4.63 |
| TPSA | 121.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|