C26H19Cl3FNO6 — CID 108715839
(4E)-1-(3-chloro-4-fluorophenyl)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-5-(3-ethoxy-4-hydroxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108715839) has the molecular formula C26H19Cl3FNO6 and a molecular weight of 566.80 g/mol. Its IUPAC name is (4E)-1-(3-chloro-4-fluorophenyl)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-5-(3-ethoxy-4-hydroxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(3-chloro-4-fluorophenyl)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-5-(3-ethoxy-4-hydroxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108715839 |
| Molecular Formula | C26H19Cl3FNO6 |
| Molecular Weight | 566.80 g/mol |
| Exact Mass | 565.03 |
| IUPAC Name | (4E)-1-(3-chloro-4-fluorophenyl)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-5-(3-ethoxy-4-hydroxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1cc(C2/C(=C(\O)c3cc(Cl)c(OC)c(Cl)c3)C(=O)C(=O)N2c2ccc(F)c(Cl)c2)ccc1O |
| InChI | InChI=1S/C26H19Cl3FNO6/c1-3-37-20-10-12(4-7-19(20)32)22-21(23(33)13-8-16(28)25(36-2)17(29)9-13)24(34)26(35)31(22)14-5-6-18(30)15(27)11-14/h4-11,22,32-33H,3H2,1-2H3/b23-21+ |
| InChIKey | RZCJGWZFAFMHLU-XTQSDGFTSA-N |
| XLogP | 6.53 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.80 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|