C27H22Cl3NO6 — CID 108716013
(4E)-1-(5-chloro-2-methylphenyl)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-5-(3-ethoxy-4-hydroxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108716013) has the molecular formula C27H22Cl3NO6 and a molecular weight of 562.83 g/mol. Its IUPAC name is (4E)-1-(5-chloro-2-methylphenyl)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-5-(3-ethoxy-4-hydroxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(5-chloro-2-methylphenyl)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-5-(3-ethoxy-4-hydroxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108716013 |
| Molecular Formula | C27H22Cl3NO6 |
| Molecular Weight | 562.83 g/mol |
| Exact Mass | 561.05 |
| IUPAC Name | (4E)-1-(5-chloro-2-methylphenyl)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-5-(3-ethoxy-4-hydroxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1cc(C2/C(=C(\O)c3cc(Cl)c(OC)c(Cl)c3)C(=O)C(=O)N2c2cc(Cl)ccc2C)ccc1O |
| InChI | InChI=1S/C27H22Cl3NO6/c1-4-37-21-11-14(6-8-20(21)32)23-22(24(33)15-9-17(29)26(36-3)18(30)10-15)25(34)27(35)31(23)19-12-16(28)7-5-13(19)2/h5-12,23,32-33H,4H2,1-3H3/b24-22+ |
| InChIKey | RLMIQFWXAAZKKV-ZNTNEXAZSA-N |
| XLogP | 6.69 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.83 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|