C30H27NO7 — CID 108718389
2-[4-[(3Z)-3-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-2-(4-tert-butylphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetic acid (PubChem CID 108718389) has the molecular formula C30H27NO7 and a molecular weight of 513.55 g/mol. Its IUPAC name is 2-[4-[(3Z)-3-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-2-(4-tert-butylphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetic acid.
| Compound Name | 2-[4-[(3Z)-3-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-2-(4-tert-butylphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 108718389 |
| Molecular Formula | C30H27NO7 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | 2-[4-[(3Z)-3-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-2-(4-tert-butylphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetic acid |
| SMILES | CC(C)(C)c1ccc(C2/C(=C(/O)c3ccc4c(c3)OCO4)C(=O)C(=O)N2c2ccc(CC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C30H27NO7/c1-30(2,3)20-9-6-18(7-10-20)26-25(27(34)19-8-13-22-23(15-19)38-16-37-22)28(35)29(36)31(26)21-11-4-17(5-12-21)14-24(32)33/h4-13,15,26,34H,14,16H2,1-3H3,(H,32,33)/b27-25- |
| InChIKey | NERUTRMPMKJZJA-RFBIWTDZSA-N |
| XLogP | 4.97 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|