C31H31NO4 — CID 108682979
(4Z)-1-(4-tert-butylphenyl)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-5-(4-ethylphenyl)pyrrolidine-2,3-dione (PubChem CID 108682979) has the molecular formula C31H31NO4 and a molecular weight of 481.59 g/mol. Its IUPAC name is (4Z)-1-(4-tert-butylphenyl)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-5-(4-ethylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-(4-tert-butylphenyl)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-5-(4-ethylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108682979 |
| Molecular Formula | C31H31NO4 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | (4Z)-1-(4-tert-butylphenyl)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-5-(4-ethylphenyl)pyrrolidine-2,3-dione |
| SMILES | CCc1ccc(C2/C(=C(/O)c3ccc4c(c3)CCO4)C(=O)C(=O)N2c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C31H31NO4/c1-5-19-6-8-20(9-7-19)27-26(28(33)22-10-15-25-21(18-22)16-17-36-25)29(34)30(35)32(27)24-13-11-23(12-14-24)31(2,3)4/h6-15,18,27,33H,5,16-17H2,1-4H3/b28-26- |
| InChIKey | CPUOPILVPSOSBN-SGEDCAFJSA-N |
| XLogP | 6.11 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|