C30H28BrNO6 — CID 108717889
methyl 4-[(3Z)-3-[(3-bromo-4-methoxyphenyl)-hydroxymethylidene]-2-(4-tert-butylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108717889) has the molecular formula C30H28BrNO6 and a molecular weight of 578.46 g/mol. Its IUPAC name is methyl 4-[(3Z)-3-[(3-bromo-4-methoxyphenyl)-hydroxymethylidene]-2-(4-tert-butylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 4-[(3Z)-3-[(3-bromo-4-methoxyphenyl)-hydroxymethylidene]-2-(4-tert-butylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108717889 |
| Molecular Formula | C30H28BrNO6 |
| Molecular Weight | 578.46 g/mol |
| Exact Mass | 577.11 |
| IUPAC Name | methyl 4-[(3Z)-3-[(3-bromo-4-methoxyphenyl)-hydroxymethylidene]-2-(4-tert-butylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)C(=O)/C(=C(\O)c3ccc(OC)c(Br)c3)C2c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C30H28BrNO6/c1-30(2,3)20-11-6-17(7-12-20)25-24(26(33)19-10-15-23(37-4)22(31)16-19)27(34)28(35)32(25)21-13-8-18(9-14-21)29(36)38-5/h6-16,25,33H,1-5H3/b26-24- |
| InChIKey | YXACTDZVAFCWDL-LCUIJRPUSA-N |
| XLogP | 6.17 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.46 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|