C30H28BrNO5 — CID 108717816
methyl 4-[(3Z)-3-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-2-(4-tert-butylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108717816) has the molecular formula C30H28BrNO5 and a molecular weight of 562.46 g/mol. Its IUPAC name is methyl 4-[(3Z)-3-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-2-(4-tert-butylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 4-[(3Z)-3-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-2-(4-tert-butylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108717816 |
| Molecular Formula | C30H28BrNO5 |
| Molecular Weight | 562.46 g/mol |
| Exact Mass | 561.12 |
| IUPAC Name | methyl 4-[(3Z)-3-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-2-(4-tert-butylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)C(=O)/C(=C(\O)c3ccc(Br)c(C)c3)C2c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C30H28BrNO5/c1-17-16-20(10-15-23(17)31)26(33)24-25(18-6-11-21(12-7-18)30(2,3)4)32(28(35)27(24)34)22-13-8-19(9-14-22)29(36)37-5/h6-16,25,33H,1-5H3/b26-24- |
| InChIKey | QCKHZXSDJCNJMU-LCUIJRPUSA-N |
| XLogP | 6.47 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.46 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|