C28H26BrNO5 — CID 108674848
(4Z)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-1,5-bis(4-ethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108674848) has the molecular formula C28H26BrNO5 and a molecular weight of 536.42 g/mol. Its IUPAC name is (4Z)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-1,5-bis(4-ethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-1,5-bis(4-ethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108674848 |
| Molecular Formula | C28H26BrNO5 |
| Molecular Weight | 536.42 g/mol |
| Exact Mass | 535.10 |
| IUPAC Name | (4Z)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-1,5-bis(4-ethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc(C2/C(=C(/O)c3ccc(Br)c(C)c3)C(=O)C(=O)N2c2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C28H26BrNO5/c1-4-34-21-11-6-18(7-12-21)25-24(26(31)19-8-15-23(29)17(3)16-19)27(32)28(33)30(25)20-9-13-22(14-10-20)35-5-2/h6-16,25,31H,4-5H2,1-3H3/b26-24- |
| InChIKey | MHIIDNBWPYUYGR-LCUIJRPUSA-N |
| XLogP | 6.18 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.42 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|