C28H26BrNO6 — CID 108708260
(4E)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-1-(3,4-diethoxyphenyl)-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108708260) has the molecular formula C28H26BrNO6 and a molecular weight of 552.42 g/mol. Its IUPAC name is (4E)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-1-(3,4-diethoxyphenyl)-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-1-(3,4-diethoxyphenyl)-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108708260 |
| Molecular Formula | C28H26BrNO6 |
| Molecular Weight | 552.42 g/mol |
| Exact Mass | 551.09 |
| IUPAC Name | (4E)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-1-(3,4-diethoxyphenyl)-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc(N2C(=O)C(=O)/C(=C(/O)c3ccc(Br)c(C)c3)C2c2ccc(O)cc2)cc1OCC |
| InChI | InChI=1S/C28H26BrNO6/c1-4-35-22-13-9-19(15-23(22)36-5-2)30-25(17-6-10-20(31)11-7-17)24(27(33)28(30)34)26(32)18-8-12-21(29)16(3)14-18/h6-15,25,31-32H,4-5H2,1-3H3/b26-24+ |
| InChIKey | PXAVUEPLHSQQQL-SHHOIMCASA-N |
| XLogP | 5.89 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.42 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|