C31H30ClNO6 — CID 108717894
methyl 4-[(3E)-2-(4-tert-butylphenyl)-3-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108717894) has the molecular formula C31H30ClNO6 and a molecular weight of 548.04 g/mol. Its IUPAC name is methyl 4-[(3E)-2-(4-tert-butylphenyl)-3-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 4-[(3E)-2-(4-tert-butylphenyl)-3-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108717894 |
| Molecular Formula | C31H30ClNO6 |
| Molecular Weight | 548.04 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | methyl 4-[(3E)-2-(4-tert-butylphenyl)-3-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)C(=O)/C(=C(/O)c3cc(C)cc(Cl)c3OC)C2c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C31H30ClNO6/c1-17-15-22(28(38-5)23(32)16-17)26(34)24-25(18-7-11-20(12-8-18)31(2,3)4)33(29(36)27(24)35)21-13-9-19(10-14-21)30(37)39-6/h7-16,25,34H,1-6H3/b26-24+ |
| InChIKey | GKEJUMRPINTJLP-SHHOIMCASA-N |
| XLogP | 6.37 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.04 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|