C29H26ClNO7 — CID 108697517
methyl 2-[4-[(3E)-3-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetate (PubChem CID 108697517) has the molecular formula C29H26ClNO7 and a molecular weight of 535.98 g/mol. Its IUPAC name is methyl 2-[4-[(3E)-3-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetate.
| Compound Name | methyl 2-[4-[(3E)-3-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetate |
|---|---|
| PubChem CID | 108697517 |
| Molecular Formula | C29H26ClNO7 |
| Molecular Weight | 535.98 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | methyl 2-[4-[(3E)-3-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(N2C(=O)C(=O)/C(=C(/O)c3cc(C)cc(Cl)c3OC)C2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C29H26ClNO7/c1-16-13-21(28(38-4)22(30)14-16)26(33)24-25(18-7-11-20(36-2)12-8-18)31(29(35)27(24)34)19-9-5-17(6-10-19)15-23(32)37-3/h5-14,25,33H,15H2,1-4H3/b26-24+ |
| InChIKey | APIKCDAIHFDHHC-SHHOIMCASA-N |
| XLogP | 5.01 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.98 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|