About (4S,5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-ol
(4S,5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-ol (PubChem CID 10867242) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is (4S,5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-ol.
Molecular Properties
| Compound Name | (4S,5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-ol |
| PubChem CID | 10867242 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (4S,5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-ol |
| SMILES | O[C@H]1C=CC[C@@]12CCCC21OCCO1 |
| InChI | InChI=1S/C11H16O3/c12-9-3-1-4-10(9)5-2-6-11(10)13-7-8-14-11/h1,3,9,12H,2,4-8H2/t9-,10+/m0/s1 |
| InChIKey | NJBNUYWXPDFDCP-VHSXEESVSA-N |
| XLogP | 1.22 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4S,5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-ol?
The IUPAC name of (4S,5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-ol (CID 10867242) is (4S,5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-ol.
What is the SMILES notation for (4S,5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-ol?
The canonical SMILES for (4S,5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-ol is O[C@H]1C=CC[C@@]12CCCC21OCCO1.
What is the InChIKey of (4S,5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-ol?
The InChIKey is NJBNUYWXPDFDCP-VHSXEESVSA-N. The full InChI is InChI=1S/C11H16O3/c12-9-3-1-4-10(9)5-2-6-11(10)13-7-8-14-11/h1,3,9,12H,2,4-8H2/t9-,10+/m0/s1.
What are the key properties of (4S,5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-ol?
(4S,5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-ol has a molecular weight of 196.25 g/mol, XLogP of 1.22, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-ol is sourced from PubChem (CID 10867242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).