C11H16O3 — CID 10867242
(4S,5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-ol (PubChem CID 10867242) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (4S,5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-ol.
| Compound Name | (4S,5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-ol |
|---|---|
| PubChem CID | 10867242 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (4S,5S)-7,10-dioxadispiro[4.0.46.35]tridec-2-en-4-ol |
| SMILES | O[C@H]1C=CC[C@@]12CCCC21OCCO1 |
| InChI | InChI=1S/C11H16O3/c12-9-3-1-4-10(9)5-2-6-11(10)13-7-8-14-11/h1,3,9,12H,2,4-8H2/t9-,10+/m0/s1 |
| InChIKey | NJBNUYWXPDFDCP-VHSXEESVSA-N |
| XLogP | 1.22 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|