C23H18ClN3O6S — CID 108672666
4-[(4E)-4-[(5-chloro-2-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-2-ylpyrrolidin-1-yl]benzenesulfonamide (PubChem CID 108672666) has the molecular formula C23H18ClN3O6S and a molecular weight of 499.93 g/mol. Its IUPAC name is 4-[(4E)-4-[(5-chloro-2-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-2-ylpyrrolidin-1-yl]benzenesulfonamide.
| Compound Name | 4-[(4E)-4-[(5-chloro-2-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-2-ylpyrrolidin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 108672666 |
| Molecular Formula | C23H18ClN3O6S |
| Molecular Weight | 499.93 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | 4-[(4E)-4-[(5-chloro-2-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-2-ylpyrrolidin-1-yl]benzenesulfonamide |
| SMILES | COc1ccc(Cl)cc1/C(O)=C1\C(=O)C(=O)N(c2ccc(S(N)(=O)=O)cc2)C1c1ccccn1 |
| InChI | InChI=1S/C23H18ClN3O6S/c1-33-18-10-5-13(24)12-16(18)21(28)19-20(17-4-2-3-11-26-17)27(23(30)22(19)29)14-6-8-15(9-7-14)34(25,31)32/h2-12,20,28H,1H3,(H2,25,31,32)/b21-19+ |
| InChIKey | JMIHDTFNMAEUJD-XUTLUUPISA-N |
| XLogP | 3.02 |
| TPSA | 139.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.93 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|