C26H25N3O7S — CID 108672694
4-[(4Z)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-2-ylpyrrolidin-1-yl]benzenesulfonamide (PubChem CID 108672694) has the molecular formula C26H25N3O7S and a molecular weight of 523.57 g/mol. Its IUPAC name is 4-[(4Z)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-2-ylpyrrolidin-1-yl]benzenesulfonamide.
| Compound Name | 4-[(4Z)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-2-ylpyrrolidin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 108672694 |
| Molecular Formula | C26H25N3O7S |
| Molecular Weight | 523.57 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | 4-[(4Z)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-2-ylpyrrolidin-1-yl]benzenesulfonamide |
| SMILES | CCOc1ccc(/C(O)=C2/C(=O)C(=O)N(c3ccc(S(N)(=O)=O)cc3)C2c2ccccn2)c(OCC)c1 |
| InChI | InChI=1S/C26H25N3O7S/c1-3-35-17-10-13-19(21(15-17)36-4-2)24(30)22-23(20-7-5-6-14-28-20)29(26(32)25(22)31)16-8-11-18(12-9-16)37(27,33)34/h5-15,23,30H,3-4H2,1-2H3,(H2,27,33,34)/b24-22- |
| InChIKey | GKRLDCZQOXUPMV-GYHWCHFESA-N |
| XLogP | 3.15 |
| TPSA | 149.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.57 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|