C30H30N2O7 — CID 108672520
propyl 3-[(4Z)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-2-ylpyrrolidin-1-yl]benzoate (PubChem CID 108672520) has the molecular formula C30H30N2O7 and a molecular weight of 530.58 g/mol. Its IUPAC name is propyl 3-[(4Z)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-2-ylpyrrolidin-1-yl]benzoate.
| Compound Name | propyl 3-[(4Z)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-2-ylpyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108672520 |
| Molecular Formula | C30H30N2O7 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | propyl 3-[(4Z)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-2-ylpyrrolidin-1-yl]benzoate |
| SMILES | CCCOC(=O)c1cccc(N2C(=O)C(=O)/C(=C(\O)c3ccc(OCC)cc3OCC)C2c2ccccn2)c1 |
| InChI | InChI=1S/C30H30N2O7/c1-4-16-39-30(36)19-10-9-11-20(17-19)32-26(23-12-7-8-15-31-23)25(28(34)29(32)35)27(33)22-14-13-21(37-5-2)18-24(22)38-6-3/h7-15,17-18,26,33H,4-6,16H2,1-3H3/b27-25- |
| InChIKey | HTVZICYRIBFTFL-RFBIWTDZSA-N |
| XLogP | 5.07 |
| TPSA | 115.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|