C30H29NO8 — CID 108682066
ethyl 3-[(3Z)-3-[(2,4-diethoxyphenyl)-hydroxymethylidene]-2-(3-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108682066) has the molecular formula C30H29NO8 and a molecular weight of 531.56 g/mol. Its IUPAC name is ethyl 3-[(3Z)-3-[(2,4-diethoxyphenyl)-hydroxymethylidene]-2-(3-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 3-[(3Z)-3-[(2,4-diethoxyphenyl)-hydroxymethylidene]-2-(3-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108682066 |
| Molecular Formula | C30H29NO8 |
| Molecular Weight | 531.56 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | ethyl 3-[(3Z)-3-[(2,4-diethoxyphenyl)-hydroxymethylidene]-2-(3-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(N2C(=O)C(=O)/C(=C(\O)c3ccc(OCC)cc3OCC)C2c2cccc(O)c2)c1 |
| InChI | InChI=1S/C30H29NO8/c1-4-37-22-13-14-23(24(17-22)38-5-2)27(33)25-26(18-9-8-12-21(32)16-18)31(29(35)28(25)34)20-11-7-10-19(15-20)30(36)39-6-3/h7-17,26,32-33H,4-6H2,1-3H3/b27-25- |
| InChIKey | SZYVOEZFPRUKKP-RFBIWTDZSA-N |
| XLogP | 4.99 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.56 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|