C27H23NO6 — CID 108682080
ethyl 3-[(3E)-3-[hydroxy-(4-methylphenyl)methylidene]-2-(3-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108682080) has the molecular formula C27H23NO6 and a molecular weight of 457.48 g/mol. Its IUPAC name is ethyl 3-[(3E)-3-[hydroxy-(4-methylphenyl)methylidene]-2-(3-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 3-[(3E)-3-[hydroxy-(4-methylphenyl)methylidene]-2-(3-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108682080 |
| Molecular Formula | C27H23NO6 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | ethyl 3-[(3E)-3-[hydroxy-(4-methylphenyl)methylidene]-2-(3-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(N2C(=O)C(=O)/C(=C(/O)c3ccc(C)cc3)C2c2cccc(O)c2)c1 |
| InChI | InChI=1S/C27H23NO6/c1-3-34-27(33)19-7-4-8-20(14-19)28-23(18-6-5-9-21(29)15-18)22(25(31)26(28)32)24(30)17-12-10-16(2)11-13-17/h4-15,23,29-30H,3H2,1-2H3/b24-22+ |
| InChIKey | NSTQIQRFWPSPRZ-ZNTNEXAZSA-N |
| XLogP | 4.50 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|