C31H32N2O6 — CID 108681370
(4Z)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-5-(3-hydroxyphenyl)-1-(4-pyrrolidin-1-ylphenyl)pyrrolidine-2,3-dione (PubChem CID 108681370) has the molecular formula C31H32N2O6 and a molecular weight of 528.61 g/mol. Its IUPAC name is (4Z)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-5-(3-hydroxyphenyl)-1-(4-pyrrolidin-1-ylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-5-(3-hydroxyphenyl)-1-(4-pyrrolidin-1-ylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108681370 |
| Molecular Formula | C31H32N2O6 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | (4Z)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-5-(3-hydroxyphenyl)-1-(4-pyrrolidin-1-ylphenyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc(/C(O)=C2/C(=O)C(=O)N(c3ccc(N4CCCC4)cc3)C2c2cccc(O)c2)c(OCC)c1 |
| InChI | InChI=1S/C31H32N2O6/c1-3-38-24-14-15-25(26(19-24)39-4-2)29(35)27-28(20-8-7-9-23(34)18-20)33(31(37)30(27)36)22-12-10-21(11-13-22)32-16-5-6-17-32/h7-15,18-19,28,34-35H,3-6,16-17H2,1-2H3/b29-27- |
| InChIKey | HRFNVBIEHBQFJF-OHYPFYFLSA-N |
| XLogP | 5.42 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|