C24H16BrN3O3 — CID 108673365
(4Z)-1-(3-bromophenyl)-4-[hydroxy(1H-indol-3-yl)methylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione (PubChem CID 108673365) has the molecular formula C24H16BrN3O3 and a molecular weight of 474.31 g/mol. Its IUPAC name is (4Z)-1-(3-bromophenyl)-4-[hydroxy(1H-indol-3-yl)methylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-(3-bromophenyl)-4-[hydroxy(1H-indol-3-yl)methylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108673365 |
| Molecular Formula | C24H16BrN3O3 |
| Molecular Weight | 474.31 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | (4Z)-1-(3-bromophenyl)-4-[hydroxy(1H-indol-3-yl)methylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2cccc(Br)c2)C(c2cccnc2)/C1=C(/O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H16BrN3O3/c25-15-6-3-7-16(11-15)28-21(14-5-4-10-26-12-14)20(23(30)24(28)31)22(29)18-13-27-19-9-2-1-8-17(18)19/h1-13,21,27,29H/b22-20- |
| InChIKey | IZMRPBRYMPAHCA-XDOYNYLZSA-N |
| XLogP | 4.95 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.31 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|