C27H18BrNO3 — CID 108678272
(4Z)-1-(3-bromophenyl)-4-[hydroxy(naphthalen-1-yl)methylidene]-5-phenylpyrrolidine-2,3-dione (PubChem CID 108678272) has the molecular formula C27H18BrNO3 and a molecular weight of 484.35 g/mol. Its IUPAC name is (4Z)-1-(3-bromophenyl)-4-[hydroxy(naphthalen-1-yl)methylidene]-5-phenylpyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-(3-bromophenyl)-4-[hydroxy(naphthalen-1-yl)methylidene]-5-phenylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108678272 |
| Molecular Formula | C27H18BrNO3 |
| Molecular Weight | 484.35 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | (4Z)-1-(3-bromophenyl)-4-[hydroxy(naphthalen-1-yl)methylidene]-5-phenylpyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2cccc(Br)c2)C(c2ccccc2)/C1=C(/O)c1cccc2ccccc12 |
| InChI | InChI=1S/C27H18BrNO3/c28-19-12-7-13-20(16-19)29-24(18-9-2-1-3-10-18)23(26(31)27(29)32)25(30)22-15-6-11-17-8-4-5-14-21(17)22/h1-16,24,30H/b25-23- |
| InChIKey | FXSMWOAKPXLSDT-BZZOAKBMSA-N |
| XLogP | 6.23 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.35 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|