C26H25N3O6S — CID 108673603
4-[(4E)-4-[hydroxy-(3-methyl-4-propan-2-yloxyphenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]benzenesulfonamide (PubChem CID 108673603) has the molecular formula C26H25N3O6S and a molecular weight of 507.57 g/mol. Its IUPAC name is 4-[(4E)-4-[hydroxy-(3-methyl-4-propan-2-yloxyphenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]benzenesulfonamide.
| Compound Name | 4-[(4E)-4-[hydroxy-(3-methyl-4-propan-2-yloxyphenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 108673603 |
| Molecular Formula | C26H25N3O6S |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | 4-[(4E)-4-[hydroxy-(3-methyl-4-propan-2-yloxyphenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]benzenesulfonamide |
| SMILES | Cc1cc(/C(O)=C2\C(=O)C(=O)N(c3ccc(S(N)(=O)=O)cc3)C2c2cccnc2)ccc1OC(C)C |
| InChI | InChI=1S/C26H25N3O6S/c1-15(2)35-21-11-6-17(13-16(21)3)24(30)22-23(18-5-4-12-28-14-18)29(26(32)25(22)31)19-7-9-20(10-8-19)36(27,33)34/h4-15,23,30H,1-3H3,(H2,27,33,34)/b24-22+ |
| InChIKey | QCENHGCGSVGPBM-ZNTNEXAZSA-N |
| XLogP | 3.45 |
| TPSA | 139.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|