C25H23N3O6S — CID 108674298
4-[(4E)-4-[(4-ethoxy-3-methylphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-4-ylpyrrolidin-1-yl]benzenesulfonamide (PubChem CID 108674298) has the molecular formula C25H23N3O6S and a molecular weight of 493.54 g/mol. Its IUPAC name is 4-[(4E)-4-[(4-ethoxy-3-methylphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-4-ylpyrrolidin-1-yl]benzenesulfonamide.
| Compound Name | 4-[(4E)-4-[(4-ethoxy-3-methylphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-4-ylpyrrolidin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 108674298 |
| Molecular Formula | C25H23N3O6S |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 4-[(4E)-4-[(4-ethoxy-3-methylphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-4-ylpyrrolidin-1-yl]benzenesulfonamide |
| SMILES | CCOc1ccc(/C(O)=C2\C(=O)C(=O)N(c3ccc(S(N)(=O)=O)cc3)C2c2ccncc2)cc1C |
| InChI | InChI=1S/C25H23N3O6S/c1-3-34-20-9-4-17(14-15(20)2)23(29)21-22(16-10-12-27-13-11-16)28(25(31)24(21)30)18-5-7-19(8-6-18)35(26,32)33/h4-14,22,29H,3H2,1-2H3,(H2,26,32,33)/b23-21+ |
| InChIKey | BIUXUTQZNNWOKL-XTQSDGFTSA-N |
| XLogP | 3.06 |
| TPSA | 139.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|