C26H24N2O7S — CID 25041666
4-[(3Z)-2-(3-ethoxy-4-hydroxyphenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]benzenesulfonamide (PubChem CID 25041666) has the molecular formula C26H24N2O7S and a molecular weight of 508.55 g/mol. Its IUPAC name is 4-[(3Z)-2-(3-ethoxy-4-hydroxyphenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]benzenesulfonamide.
| Compound Name | 4-[(3Z)-2-(3-ethoxy-4-hydroxyphenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 25041666 |
| Molecular Formula | C26H24N2O7S |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | 4-[(3Z)-2-(3-ethoxy-4-hydroxyphenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]benzenesulfonamide |
| SMILES | CCOc1cc(C2/C(=C(/O)c3ccc(C)cc3)C(=O)C(=O)N2c2ccc(S(N)(=O)=O)cc2)ccc1O |
| InChI | InChI=1S/C26H24N2O7S/c1-3-35-21-14-17(8-13-20(21)29)23-22(24(30)16-6-4-15(2)5-7-16)25(31)26(32)28(23)18-9-11-19(12-10-18)36(27,33)34/h4-14,23,29-30H,3H2,1-2H3,(H2,27,33,34)/b24-22- |
| InChIKey | FXYIHXHUSLDCAG-GYHWCHFESA-N |
| XLogP | 3.37 |
| TPSA | 147.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|