C24H19BrN2O7S — CID 4921729
4-[3-[(4-bromophenyl)-hydroxymethylidene]-2-(4-hydroxy-3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzenesulfonamide (PubChem CID 4921729) has the molecular formula C24H19BrN2O7S and a molecular weight of 559.39 g/mol. Its IUPAC name is 4-[3-[(4-bromophenyl)-hydroxymethylidene]-2-(4-hydroxy-3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzenesulfonamide.
| Compound Name | 4-[3-[(4-bromophenyl)-hydroxymethylidene]-2-(4-hydroxy-3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 4921729 |
| Molecular Formula | C24H19BrN2O7S |
| Molecular Weight | 559.39 g/mol |
| Exact Mass | 558.01 |
| IUPAC Name | 4-[3-[(4-bromophenyl)-hydroxymethylidene]-2-(4-hydroxy-3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzenesulfonamide |
| SMILES | COc1cc(C2C(=C(O)c3ccc(Br)cc3)C(=O)C(=O)N2c2ccc(S(N)(=O)=O)cc2)ccc1O |
| InChI | InChI=1S/C24H19BrN2O7S/c1-34-19-12-14(4-11-18(19)28)21-20(22(29)13-2-5-15(25)6-3-13)23(30)24(31)27(21)16-7-9-17(10-8-16)35(26,32)33/h2-12,21,28-29H,1H3,(H2,26,32,33) |
| InChIKey | SXNYTZALQSGBIO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 147.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|