C25H18Cl3NO4 — CID 108676713
(4Z)-5-(3-chloro-4-hydroxyphenyl)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-1-(4-ethylphenyl)pyrrolidine-2,3-dione (PubChem CID 108676713) has the molecular formula C25H18Cl3NO4 and a molecular weight of 502.78 g/mol. Its IUPAC name is (4Z)-5-(3-chloro-4-hydroxyphenyl)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-1-(4-ethylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-5-(3-chloro-4-hydroxyphenyl)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-1-(4-ethylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108676713 |
| Molecular Formula | C25H18Cl3NO4 |
| Molecular Weight | 502.78 g/mol |
| Exact Mass | 501.03 |
| IUPAC Name | (4Z)-5-(3-chloro-4-hydroxyphenyl)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-1-(4-ethylphenyl)pyrrolidine-2,3-dione |
| SMILES | CCc1ccc(N2C(=O)C(=O)/C(=C(\O)c3ccc(Cl)c(Cl)c3)C2c2ccc(O)c(Cl)c2)cc1 |
| InChI | InChI=1S/C25H18Cl3NO4/c1-2-13-3-7-16(8-4-13)29-22(14-6-10-20(30)19(28)11-14)21(24(32)25(29)33)23(31)15-5-9-17(26)18(27)12-15/h3-12,22,30-31H,2H2,1H3/b23-21- |
| InChIKey | YAHCXSAUESMBFU-LNVKXUELSA-N |
| XLogP | 6.54 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.78 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|