C29H28Cl2N2O3 — CID 108710255
(4Z)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-[4-(diethylamino)phenyl]-1-(4-ethylphenyl)pyrrolidine-2,3-dione (PubChem CID 108710255) has the molecular formula C29H28Cl2N2O3 and a molecular weight of 523.46 g/mol. Its IUPAC name is (4Z)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-[4-(diethylamino)phenyl]-1-(4-ethylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-[4-(diethylamino)phenyl]-1-(4-ethylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108710255 |
| Molecular Formula | C29H28Cl2N2O3 |
| Molecular Weight | 523.46 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | (4Z)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-[4-(diethylamino)phenyl]-1-(4-ethylphenyl)pyrrolidine-2,3-dione |
| SMILES | CCc1ccc(N2C(=O)C(=O)/C(=C(\O)c3ccc(Cl)c(Cl)c3)C2c2ccc(N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C29H28Cl2N2O3/c1-4-18-7-12-22(13-8-18)33-26(19-9-14-21(15-10-19)32(5-2)6-3)25(28(35)29(33)36)27(34)20-11-16-23(30)24(31)17-20/h7-17,26,34H,4-6H2,1-3H3/b27-25- |
| InChIKey | JQIVNAKZXWTRGM-RFBIWTDZSA-N |
| XLogP | 7.03 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.46 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|