C30H31FN2O3 — CID 108710253
(4Z)-5-[4-(diethylamino)phenyl]-1-(4-ethylphenyl)-4-[(4-fluoro-3-methylphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione (PubChem CID 108710253) has the molecular formula C30H31FN2O3 and a molecular weight of 486.59 g/mol. Its IUPAC name is (4Z)-5-[4-(diethylamino)phenyl]-1-(4-ethylphenyl)-4-[(4-fluoro-3-methylphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-5-[4-(diethylamino)phenyl]-1-(4-ethylphenyl)-4-[(4-fluoro-3-methylphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108710253 |
| Molecular Formula | C30H31FN2O3 |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | (4Z)-5-[4-(diethylamino)phenyl]-1-(4-ethylphenyl)-4-[(4-fluoro-3-methylphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione |
| SMILES | CCc1ccc(N2C(=O)C(=O)/C(=C(\O)c3ccc(F)c(C)c3)C2c2ccc(N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C30H31FN2O3/c1-5-20-8-13-24(14-9-20)33-27(21-10-15-23(16-11-21)32(6-2)7-3)26(29(35)30(33)36)28(34)22-12-17-25(31)19(4)18-22/h8-18,27,34H,5-7H2,1-4H3/b28-26- |
| InChIKey | XBZHSNLMNHQNKR-SGEDCAFJSA-N |
| XLogP | 6.17 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|