C30H32BrN3O3 — CID 108705580
(4Z)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-1-[4-(diethylamino)phenyl]-5-[4-(dimethylamino)phenyl]pyrrolidine-2,3-dione (PubChem CID 108705580) has the molecular formula C30H32BrN3O3 and a molecular weight of 562.51 g/mol. Its IUPAC name is (4Z)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-1-[4-(diethylamino)phenyl]-5-[4-(dimethylamino)phenyl]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-1-[4-(diethylamino)phenyl]-5-[4-(dimethylamino)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108705580 |
| Molecular Formula | C30H32BrN3O3 |
| Molecular Weight | 562.51 g/mol |
| Exact Mass | 561.16 |
| IUPAC Name | (4Z)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-1-[4-(diethylamino)phenyl]-5-[4-(dimethylamino)phenyl]pyrrolidine-2,3-dione |
| SMILES | CCN(CC)c1ccc(N2C(=O)C(=O)/C(=C(\O)c3ccc(Br)c(C)c3)C2c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C30H32BrN3O3/c1-6-33(7-2)23-13-15-24(16-14-23)34-27(20-8-11-22(12-9-20)32(4)5)26(29(36)30(34)37)28(35)21-10-17-25(31)19(3)18-21/h8-18,27,35H,6-7H2,1-5H3/b28-26- |
| InChIKey | BDTHSHJASFPDOM-SGEDCAFJSA-N |
| XLogP | 6.30 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.51 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|