C27H23ClFNO3 — CID 108683193
(4E)-1-(3-chloro-4-fluorophenyl)-4-[(3,4-dimethylphenyl)-hydroxymethylidene]-5-(4-ethylphenyl)pyrrolidine-2,3-dione (PubChem CID 108683193) has the molecular formula C27H23ClFNO3 and a molecular weight of 463.94 g/mol. Its IUPAC name is (4E)-1-(3-chloro-4-fluorophenyl)-4-[(3,4-dimethylphenyl)-hydroxymethylidene]-5-(4-ethylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(3-chloro-4-fluorophenyl)-4-[(3,4-dimethylphenyl)-hydroxymethylidene]-5-(4-ethylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108683193 |
| Molecular Formula | C27H23ClFNO3 |
| Molecular Weight | 463.94 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | (4E)-1-(3-chloro-4-fluorophenyl)-4-[(3,4-dimethylphenyl)-hydroxymethylidene]-5-(4-ethylphenyl)pyrrolidine-2,3-dione |
| SMILES | CCc1ccc(C2/C(=C(\O)c3ccc(C)c(C)c3)C(=O)C(=O)N2c2ccc(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C27H23ClFNO3/c1-4-17-6-9-18(10-7-17)24-23(25(31)19-8-5-15(2)16(3)13-19)26(32)27(33)30(24)20-11-12-22(29)21(28)14-20/h5-14,24,31H,4H2,1-3H3/b25-23+ |
| InChIKey | GKWRUSGZASVGQX-WJTDDFOZSA-N |
| XLogP | 6.28 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.94 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|