C31H25NO5 — CID 108677347
(4Z)-4-[3,4-dihydro-2H-chromen-6-yl(hydroxy)methylidene]-1-(4-methoxyphenyl)-5-naphthalen-1-ylpyrrolidine-2,3-dione (PubChem CID 108677347) has the molecular formula C31H25NO5 and a molecular weight of 491.54 g/mol. Its IUPAC name is (4Z)-4-[3,4-dihydro-2H-chromen-6-yl(hydroxy)methylidene]-1-(4-methoxyphenyl)-5-naphthalen-1-ylpyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[3,4-dihydro-2H-chromen-6-yl(hydroxy)methylidene]-1-(4-methoxyphenyl)-5-naphthalen-1-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108677347 |
| Molecular Formula | C31H25NO5 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | (4Z)-4-[3,4-dihydro-2H-chromen-6-yl(hydroxy)methylidene]-1-(4-methoxyphenyl)-5-naphthalen-1-ylpyrrolidine-2,3-dione |
| SMILES | COc1ccc(N2C(=O)C(=O)/C(=C(\O)c3ccc4c(c3)CCCO4)C2c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C31H25NO5/c1-36-23-14-12-22(13-15-23)32-28(25-10-4-7-19-6-2-3-9-24(19)25)27(30(34)31(32)35)29(33)21-11-16-26-20(18-21)8-5-17-37-26/h2-4,6-7,9-16,18,28,33H,5,8,17H2,1H3/b29-27- |
| InChIKey | UXSOHKSBHIPHTB-OHYPFYFLSA-N |
| XLogP | 5.80 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|