C10H16O4S — CID 10868168
methyl (4R,5S)-2,2,4-trimethyl-5-[(2R)-thiiran-2-yl]-1,3-dioxolane-4-carboxylate (PubChem CID 10868168) has the molecular formula C10H16O4S and a molecular weight of 232.30 g/mol. Its IUPAC name is methyl (4R,5S)-2,2,4-trimethyl-5-[(2R)-thiiran-2-yl]-1,3-dioxolane-4-carboxylate.
| Compound Name | methyl (4R,5S)-2,2,4-trimethyl-5-[(2R)-thiiran-2-yl]-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 10868168 |
| Molecular Formula | C10H16O4S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | methyl (4R,5S)-2,2,4-trimethyl-5-[(2R)-thiiran-2-yl]-1,3-dioxolane-4-carboxylate |
| SMILES | COC(=O)[C@]1(C)OC(C)(C)O[C@@H]1[C@@H]1CS1 |
| InChI | InChI=1S/C10H16O4S/c1-9(2)13-7(6-5-15-6)10(3,14-9)8(11)12-4/h6-7H,5H2,1-4H3/t6-,7+,10+/m0/s1 |
| InChIKey | INKGQPFOBYBECH-NYNCVSEMSA-N |
| XLogP | 1.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|