C8H12O4S — CID 130971569
(4R,5S)-2,2-dimethyl-5-[(2R)-thiiran-2-yl]-1,3-dioxolane-4-carboxylic acid (PubChem CID 130971569) has the molecular formula C8H12O4S and a molecular weight of 204.25 g/mol. Its IUPAC name is (4R,5S)-2,2-dimethyl-5-[(2R)-thiiran-2-yl]-1,3-dioxolane-4-carboxylic acid.
| Compound Name | (4R,5S)-2,2-dimethyl-5-[(2R)-thiiran-2-yl]-1,3-dioxolane-4-carboxylic acid |
|---|---|
| PubChem CID | 130971569 |
| Molecular Formula | C8H12O4S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | (4R,5S)-2,2-dimethyl-5-[(2R)-thiiran-2-yl]-1,3-dioxolane-4-carboxylic acid |
| SMILES | CC1(C)O[C@H]([C@@H]2CS2)[C@H](C(=O)O)O1 |
| InChI | InChI=1S/C8H12O4S/c1-8(2)11-5(4-3-13-4)6(12-8)7(9)10/h4-6H,3H2,1-2H3,(H,9,10)/t4-,5+,6+/m0/s1 |
| InChIKey | URSHWMJBNQETOH-KVQBGUIXSA-N |
| XLogP | 0.71 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|