C29H26N2O7 — CID 108681905
methyl 2-[4-[(3Z)-3-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-2-(3-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetate (PubChem CID 108681905) has the molecular formula C29H26N2O7 and a molecular weight of 514.53 g/mol. Its IUPAC name is methyl 2-[4-[(3Z)-3-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-2-(3-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetate.
| Compound Name | methyl 2-[4-[(3Z)-3-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-2-(3-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetate |
|---|---|
| PubChem CID | 108681905 |
| Molecular Formula | C29H26N2O7 |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | methyl 2-[4-[(3Z)-3-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-2-(3-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(N2C(=O)C(=O)/C(=C(\O)c3ccc4c(c3)N(C)CCO4)C2c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C29H26N2O7/c1-30-12-13-38-23-11-8-19(16-22(23)30)27(34)25-26(18-4-3-5-21(32)15-18)31(29(36)28(25)35)20-9-6-17(7-10-20)14-24(33)37-2/h3-11,15-16,26,32,34H,12-14H2,1-2H3/b27-25- |
| InChIKey | UALCOJCRWNWCGY-RFBIWTDZSA-N |
| XLogP | 3.56 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|