C27H21F3N2O5 — CID 108682252
(4Z)-4-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-5-(3-hydroxyphenyl)-1-[4-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione (PubChem CID 108682252) has the molecular formula C27H21F3N2O5 and a molecular weight of 510.47 g/mol. Its IUPAC name is (4Z)-4-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-5-(3-hydroxyphenyl)-1-[4-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-5-(3-hydroxyphenyl)-1-[4-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108682252 |
| Molecular Formula | C27H21F3N2O5 |
| Molecular Weight | 510.47 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | (4Z)-4-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-5-(3-hydroxyphenyl)-1-[4-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione |
| SMILES | CN1CCOc2ccc(/C(O)=C3/C(=O)C(=O)N(c4ccc(C(F)(F)F)cc4)C3c3cccc(O)c3)cc21 |
| InChI | InChI=1S/C27H21F3N2O5/c1-31-11-12-37-21-10-5-16(14-20(21)31)24(34)22-23(15-3-2-4-19(33)13-15)32(26(36)25(22)35)18-8-6-17(7-9-18)27(28,29)30/h2-10,13-14,23,33-34H,11-12H2,1H3/b24-22- |
| InChIKey | RPHLVGYAUXWLJE-GYHWCHFESA-N |
| XLogP | 4.87 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.47 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|