C24H15F4NO4 — CID 108682254
(4E)-4-[(4-fluorophenyl)-hydroxymethylidene]-5-(3-hydroxyphenyl)-1-[4-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione (PubChem CID 108682254) has the molecular formula C24H15F4NO4 and a molecular weight of 457.38 g/mol. Its IUPAC name is (4E)-4-[(4-fluorophenyl)-hydroxymethylidene]-5-(3-hydroxyphenyl)-1-[4-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-fluorophenyl)-hydroxymethylidene]-5-(3-hydroxyphenyl)-1-[4-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108682254 |
| Molecular Formula | C24H15F4NO4 |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | (4E)-4-[(4-fluorophenyl)-hydroxymethylidene]-5-(3-hydroxyphenyl)-1-[4-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2ccc(C(F)(F)F)cc2)C(c2cccc(O)c2)/C1=C(\O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H15F4NO4/c25-16-8-4-13(5-9-16)21(31)19-20(14-2-1-3-18(30)12-14)29(23(33)22(19)32)17-10-6-15(7-11-17)24(26,27)28/h1-12,20,30-31H/b21-19+ |
| InChIKey | YMDMLLXEWKQBNK-XUTLUUPISA-N |
| XLogP | 5.18 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|