C24H16BrFN2O6 — CID 108682479
(4Z)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-1-(3-fluorophenyl)-5-(4-hydroxy-3-nitrophenyl)pyrrolidine-2,3-dione (PubChem CID 108682479) has the molecular formula C24H16BrFN2O6 and a molecular weight of 527.30 g/mol. Its IUPAC name is (4Z)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-1-(3-fluorophenyl)-5-(4-hydroxy-3-nitrophenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-1-(3-fluorophenyl)-5-(4-hydroxy-3-nitrophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108682479 |
| Molecular Formula | C24H16BrFN2O6 |
| Molecular Weight | 527.30 g/mol |
| Exact Mass | 526.02 |
| IUPAC Name | (4Z)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-1-(3-fluorophenyl)-5-(4-hydroxy-3-nitrophenyl)pyrrolidine-2,3-dione |
| SMILES | Cc1cc(/C(O)=C2/C(=O)C(=O)N(c3cccc(F)c3)C2c2ccc(O)c([N+](=O)[O-])c2)ccc1Br |
| InChI | InChI=1S/C24H16BrFN2O6/c1-12-9-14(5-7-17(12)25)22(30)20-21(13-6-8-19(29)18(10-13)28(33)34)27(24(32)23(20)31)16-4-2-3-15(26)11-16/h2-11,21,29-30H,1H3/b22-20- |
| InChIKey | CCPFVOATSHXQIO-XDOYNYLZSA-N |
| XLogP | 5.14 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.30 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|