C25H17FN2O7 — CID 108682631
(4E)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-1-(4-fluorophenyl)-5-(4-hydroxy-3-nitrophenyl)pyrrolidine-2,3-dione (PubChem CID 108682631) has the molecular formula C25H17FN2O7 and a molecular weight of 476.42 g/mol. Its IUPAC name is (4E)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-1-(4-fluorophenyl)-5-(4-hydroxy-3-nitrophenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-1-(4-fluorophenyl)-5-(4-hydroxy-3-nitrophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108682631 |
| Molecular Formula | C25H17FN2O7 |
| Molecular Weight | 476.42 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | (4E)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-1-(4-fluorophenyl)-5-(4-hydroxy-3-nitrophenyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2ccc(F)cc2)C(c2ccc(O)c([N+](=O)[O-])c2)/C1=C(\O)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C25H17FN2O7/c26-16-3-5-17(6-4-16)27-22(14-1-7-19(29)18(12-14)28(33)34)21(24(31)25(27)32)23(30)15-2-8-20-13(11-15)9-10-35-20/h1-8,11-12,22,29-30H,9-10H2/b23-21+ |
| InChIKey | PZMKLYXVGOWWLP-XTQSDGFTSA-N |
| XLogP | 4.00 |
| TPSA | 130.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|