C25H16F3NO4 — CID 108601501
(4Z)-1-(2,4-difluorophenyl)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-5-(4-fluorophenyl)pyrrolidine-2,3-dione (PubChem CID 108601501) has the molecular formula C25H16F3NO4 and a molecular weight of 451.40 g/mol. Its IUPAC name is (4Z)-1-(2,4-difluorophenyl)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-5-(4-fluorophenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-(2,4-difluorophenyl)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-5-(4-fluorophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108601501 |
| Molecular Formula | C25H16F3NO4 |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | (4Z)-1-(2,4-difluorophenyl)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-5-(4-fluorophenyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2ccc(F)cc2F)C(c2ccc(F)cc2)/C1=C(/O)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C25H16F3NO4/c26-16-4-1-13(2-5-16)22-21(23(30)15-3-8-20-14(11-15)9-10-33-20)24(31)25(32)29(22)19-7-6-17(27)12-18(19)28/h1-8,11-12,22,30H,9-10H2/b23-21- |
| InChIKey | ZWKCGKJSWCDNKH-LNVKXUELSA-N |
| XLogP | 4.67 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|