C30H28F2N2O4 — CID 108711237
(4Z)-5-[4-(diethylamino)phenyl]-1-(2,5-difluorophenyl)-4-[3,4-dihydro-2H-chromen-6-yl(hydroxy)methylidene]pyrrolidine-2,3-dione (PubChem CID 108711237) has the molecular formula C30H28F2N2O4 and a molecular weight of 518.56 g/mol. Its IUPAC name is (4Z)-5-[4-(diethylamino)phenyl]-1-(2,5-difluorophenyl)-4-[3,4-dihydro-2H-chromen-6-yl(hydroxy)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-5-[4-(diethylamino)phenyl]-1-(2,5-difluorophenyl)-4-[3,4-dihydro-2H-chromen-6-yl(hydroxy)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108711237 |
| Molecular Formula | C30H28F2N2O4 |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | (4Z)-5-[4-(diethylamino)phenyl]-1-(2,5-difluorophenyl)-4-[3,4-dihydro-2H-chromen-6-yl(hydroxy)methylidene]pyrrolidine-2,3-dione |
| SMILES | CCN(CC)c1ccc(C2/C(=C(/O)c3ccc4c(c3)CCCO4)C(=O)C(=O)N2c2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C30H28F2N2O4/c1-3-33(4-2)22-11-7-18(8-12-22)27-26(28(35)20-9-14-25-19(16-20)6-5-15-38-25)29(36)30(37)34(27)24-17-21(31)10-13-23(24)32/h7-14,16-17,27,35H,3-6,15H2,1-2H3/b28-26- |
| InChIKey | VFAYLBQURJNMJQ-SGEDCAFJSA-N |
| XLogP | 5.76 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|