C32H34N2O4 — CID 108710847
(4Z)-5-[4-(diethylamino)phenyl]-4-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]-1-(2-methoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108710847) has the molecular formula C32H34N2O4 and a molecular weight of 510.63 g/mol. Its IUPAC name is (4Z)-5-[4-(diethylamino)phenyl]-4-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]-1-(2-methoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-5-[4-(diethylamino)phenyl]-4-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]-1-(2-methoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108710847 |
| Molecular Formula | C32H34N2O4 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | (4Z)-5-[4-(diethylamino)phenyl]-4-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]-1-(2-methoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCN(CC)c1ccc(C2/C(=C(/O)c3ccc4c(c3)CCCC4)C(=O)C(=O)N2c2ccccc2OC)cc1 |
| InChI | InChI=1S/C32H34N2O4/c1-4-33(5-2)25-18-16-22(17-19-25)29-28(30(35)24-15-14-21-10-6-7-11-23(21)20-24)31(36)32(37)34(29)26-12-8-9-13-27(26)38-3/h8-9,12-20,29,35H,4-7,10-11H2,1-3H3/b30-28- |
| InChIKey | YMEGWQWXPLSXPB-HYOGKJQXSA-N |
| XLogP | 6.05 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|