C32H32N4O3 — CID 108711456
(4E)-1-(1H-benzimidazol-2-yl)-5-[4-(diethylamino)phenyl]-4-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]pyrrolidine-2,3-dione (PubChem CID 108711456) has the molecular formula C32H32N4O3 and a molecular weight of 520.63 g/mol. Its IUPAC name is (4E)-1-(1H-benzimidazol-2-yl)-5-[4-(diethylamino)phenyl]-4-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(1H-benzimidazol-2-yl)-5-[4-(diethylamino)phenyl]-4-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108711456 |
| Molecular Formula | C32H32N4O3 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | (4E)-1-(1H-benzimidazol-2-yl)-5-[4-(diethylamino)phenyl]-4-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]pyrrolidine-2,3-dione |
| SMILES | CCN(CC)c1ccc(C2/C(=C(\O)c3ccc4c(c3)CCCC4)C(=O)C(=O)N2c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C32H32N4O3/c1-3-35(4-2)24-17-15-21(16-18-24)28-27(29(37)23-14-13-20-9-5-6-10-22(20)19-23)30(38)31(39)36(28)32-33-25-11-7-8-12-26(25)34-32/h7-8,11-19,28,37H,3-6,9-10H2,1-2H3,(H,33,34)/b29-27+ |
| InChIKey | HOWYLATXJLYGDJ-ORIPQNMZSA-N |
| XLogP | 5.91 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|