C30H27N3O5 — CID 108701552
(4E)-1-(1H-benzimidazol-2-yl)-5-(3,4-dimethoxyphenyl)-4-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]pyrrolidine-2,3-dione (PubChem CID 108701552) has the molecular formula C30H27N3O5 and a molecular weight of 509.56 g/mol. Its IUPAC name is (4E)-1-(1H-benzimidazol-2-yl)-5-(3,4-dimethoxyphenyl)-4-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(1H-benzimidazol-2-yl)-5-(3,4-dimethoxyphenyl)-4-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108701552 |
| Molecular Formula | C30H27N3O5 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | (4E)-1-(1H-benzimidazol-2-yl)-5-(3,4-dimethoxyphenyl)-4-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C2/C(=C(\O)c3ccc4c(c3)CCCC4)C(=O)C(=O)N2c2nc3ccccc3[nH]2)cc1OC |
| InChI | InChI=1S/C30H27N3O5/c1-37-23-14-13-19(16-24(23)38-2)26-25(27(34)20-12-11-17-7-3-4-8-18(17)15-20)28(35)29(36)33(26)30-31-21-9-5-6-10-22(21)32-30/h5-6,9-16,26,34H,3-4,7-8H2,1-2H3,(H,31,32)/b27-25+ |
| InChIKey | NGCGVVBMKDNFSK-IMVLJIQESA-N |
| XLogP | 5.09 |
| TPSA | 104.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|