C28H17N3O6 — CID 108682710
4-[(3E)-3-[hydroxy(naphthalen-2-yl)methylidene]-2-(4-hydroxy-3-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile (PubChem CID 108682710) has the molecular formula C28H17N3O6 and a molecular weight of 491.46 g/mol. Its IUPAC name is 4-[(3E)-3-[hydroxy(naphthalen-2-yl)methylidene]-2-(4-hydroxy-3-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile.
| Compound Name | 4-[(3E)-3-[hydroxy(naphthalen-2-yl)methylidene]-2-(4-hydroxy-3-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 108682710 |
| Molecular Formula | C28H17N3O6 |
| Molecular Weight | 491.46 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | 4-[(3E)-3-[hydroxy(naphthalen-2-yl)methylidene]-2-(4-hydroxy-3-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2C(=O)C(=O)/C(=C(/O)c3ccc4ccccc4c3)C2c2ccc(O)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C28H17N3O6/c29-15-16-5-10-21(11-6-16)30-25(19-9-12-23(32)22(14-19)31(36)37)24(27(34)28(30)35)26(33)20-8-7-17-3-1-2-4-18(17)13-20/h1-14,25,32-33H/b26-24+ |
| InChIKey | LEPJNRZQWGDIKN-SHHOIMCASA-N |
| XLogP | 4.95 |
| TPSA | 144.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|