C28H23N3O8 — CID 108682674
4-[(3Z)-3-[(2,4-diethoxyphenyl)-hydroxymethylidene]-2-(4-hydroxy-3-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile (PubChem CID 108682674) has the molecular formula C28H23N3O8 and a molecular weight of 529.51 g/mol. Its IUPAC name is 4-[(3Z)-3-[(2,4-diethoxyphenyl)-hydroxymethylidene]-2-(4-hydroxy-3-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile.
| Compound Name | 4-[(3Z)-3-[(2,4-diethoxyphenyl)-hydroxymethylidene]-2-(4-hydroxy-3-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 108682674 |
| Molecular Formula | C28H23N3O8 |
| Molecular Weight | 529.51 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | 4-[(3Z)-3-[(2,4-diethoxyphenyl)-hydroxymethylidene]-2-(4-hydroxy-3-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile |
| SMILES | CCOc1ccc(/C(O)=C2/C(=O)C(=O)N(c3ccc(C#N)cc3)C2c2ccc(O)c([N+](=O)[O-])c2)c(OCC)c1 |
| InChI | InChI=1S/C28H23N3O8/c1-3-38-19-10-11-20(23(14-19)39-4-2)26(33)24-25(17-7-12-22(32)21(13-17)31(36)37)30(28(35)27(24)34)18-8-5-16(15-29)6-9-18/h5-14,25,32-33H,3-4H2,1-2H3/b26-24- |
| InChIKey | YDQHDMIGGOEHCY-LCUIJRPUSA-N |
| XLogP | 4.60 |
| TPSA | 163.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.51 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|