C26H19N3O8 — CID 108682663
4-[(3E)-3-[(2,5-dimethoxyphenyl)-hydroxymethylidene]-2-(4-hydroxy-3-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile (PubChem CID 108682663) has the molecular formula C26H19N3O8 and a molecular weight of 501.45 g/mol. Its IUPAC name is 4-[(3E)-3-[(2,5-dimethoxyphenyl)-hydroxymethylidene]-2-(4-hydroxy-3-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile.
| Compound Name | 4-[(3E)-3-[(2,5-dimethoxyphenyl)-hydroxymethylidene]-2-(4-hydroxy-3-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 108682663 |
| Molecular Formula | C26H19N3O8 |
| Molecular Weight | 501.45 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | 4-[(3E)-3-[(2,5-dimethoxyphenyl)-hydroxymethylidene]-2-(4-hydroxy-3-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile |
| SMILES | COc1ccc(OC)c(/C(O)=C2\C(=O)C(=O)N(c3ccc(C#N)cc3)C2c2ccc(O)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C26H19N3O8/c1-36-17-8-10-21(37-2)18(12-17)24(31)22-23(15-5-9-20(30)19(11-15)29(34)35)28(26(33)25(22)32)16-6-3-14(13-27)4-7-16/h3-12,23,30-31H,1-2H3/b24-22+ |
| InChIKey | PZGBYHMJRXWTSF-ZNTNEXAZSA-N |
| XLogP | 3.82 |
| TPSA | 163.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|