C12H16O3S — CID 10868408
(2S,5S)-2-(benzenesulfonylmethyl)-5-methyloxolane (PubChem CID 10868408) has the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. Its IUPAC name is (2S,5S)-2-(benzenesulfonylmethyl)-5-methyloxolane.
| Compound Name | (2S,5S)-2-(benzenesulfonylmethyl)-5-methyloxolane |
|---|---|
| PubChem CID | 10868408 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | (2S,5S)-2-(benzenesulfonylmethyl)-5-methyloxolane |
| SMILES | C[C@H]1CC[C@@H](CS(=O)(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C12H16O3S/c1-10-7-8-11(15-10)9-16(13,14)12-5-3-2-4-6-12/h2-6,10-11H,7-9H2,1H3/t10-,11-/m0/s1 |
| InChIKey | DLPSHHSRQHKVGE-QWRGUYRKSA-N |
| XLogP | 2.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |