C8H16O4S2 — CID 10868410
(1R,2R,3S,4S)-1-(1,3-dithiolan-2-yl)pentane-1,2,3,4-tetrol (PubChem CID 10868410) has the molecular formula C8H16O4S2 and a molecular weight of 240.35 g/mol. Its IUPAC name is (1R,2R,3S,4S)-1-(1,3-dithiolan-2-yl)pentane-1,2,3,4-tetrol.
| Compound Name | (1R,2R,3S,4S)-1-(1,3-dithiolan-2-yl)pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 10868410 |
| Molecular Formula | C8H16O4S2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | (1R,2R,3S,4S)-1-(1,3-dithiolan-2-yl)pentane-1,2,3,4-tetrol |
| SMILES | C[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)C1SCCS1 |
| InChI | InChI=1S/C8H16O4S2/c1-4(9)5(10)6(11)7(12)8-13-2-3-14-8/h4-12H,2-3H2,1H3/t4-,5-,6+,7+/m0/s1 |
| InChIKey | FOQSWOQCFBCQCX-VWDOSNQTSA-N |
| XLogP | -0.74 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |