C27H20Cl2N2O4 — CID 108684434
(4E)-4-[(2-chloro-5-methoxyphenyl)-hydroxymethylidene]-1-(3-chlorophenyl)-5-(1-methylindol-3-yl)pyrrolidine-2,3-dione (PubChem CID 108684434) has the molecular formula C27H20Cl2N2O4 and a molecular weight of 507.37 g/mol. Its IUPAC name is (4E)-4-[(2-chloro-5-methoxyphenyl)-hydroxymethylidene]-1-(3-chlorophenyl)-5-(1-methylindol-3-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(2-chloro-5-methoxyphenyl)-hydroxymethylidene]-1-(3-chlorophenyl)-5-(1-methylindol-3-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108684434 |
| Molecular Formula | C27H20Cl2N2O4 |
| Molecular Weight | 507.37 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | (4E)-4-[(2-chloro-5-methoxyphenyl)-hydroxymethylidene]-1-(3-chlorophenyl)-5-(1-methylindol-3-yl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(Cl)c(/C(O)=C2\C(=O)C(=O)N(c3cccc(Cl)c3)C2c2cn(C)c3ccccc23)c1 |
| InChI | InChI=1S/C27H20Cl2N2O4/c1-30-14-20(18-8-3-4-9-22(18)30)24-23(25(32)19-13-17(35-2)10-11-21(19)29)26(33)27(34)31(24)16-7-5-6-15(28)12-16/h3-14,24,32H,1-2H3/b25-23+ |
| InChIKey | PXLQCZMYSCVNDX-WJTDDFOZSA-N |
| XLogP | 6.12 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.37 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|