C11H21NOS2 — CID 10868624
4-[3,3-bis(ethylsulfanyl)prop-2-enyl]morpholine (PubChem CID 10868624) has the molecular formula C11H21NOS2 and a molecular weight of 247.43 g/mol. Its IUPAC name is 4-[3,3-bis(ethylsulfanyl)prop-2-enyl]morpholine.
| Compound Name | 4-[3,3-bis(ethylsulfanyl)prop-2-enyl]morpholine |
|---|---|
| PubChem CID | 10868624 |
| Molecular Formula | C11H21NOS2 |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 4-[3,3-bis(ethylsulfanyl)prop-2-enyl]morpholine |
| SMILES | CCSC(=CCN1CCOCC1)SCC |
| InChI | InChI=1S/C11H21NOS2/c1-3-14-11(15-4-2)5-6-12-7-9-13-10-8-12/h5H,3-4,6-10H2,1-2H3 |
| InChIKey | XZKGCMPOHZADTB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |