C29H24N2O6 — CID 108686565
(4E)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(4-methoxyphenyl)-5-(2-methyl-1H-indol-3-yl)pyrrolidine-2,3-dione (PubChem CID 108686565) has the molecular formula C29H24N2O6 and a molecular weight of 496.52 g/mol. Its IUPAC name is (4E)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(4-methoxyphenyl)-5-(2-methyl-1H-indol-3-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(4-methoxyphenyl)-5-(2-methyl-1H-indol-3-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108686565 |
| Molecular Formula | C29H24N2O6 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | (4E)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(4-methoxyphenyl)-5-(2-methyl-1H-indol-3-yl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(N2C(=O)C(=O)/C(=C(/O)c3ccc4c(c3)OCCO4)C2c2c(C)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C29H24N2O6/c1-16-24(20-5-3-4-6-21(20)30-16)26-25(27(32)17-7-12-22-23(15-17)37-14-13-36-22)28(33)29(34)31(26)18-8-10-19(35-2)11-9-18/h3-12,15,26,30,32H,13-14H2,1-2H3/b27-25+ |
| InChIKey | NPGZMQBNLHBPIO-IMVLJIQESA-N |
| XLogP | 4.88 |
| TPSA | 101.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|